Didesmethyl Almotriptan-d4 is a deuterated research compound, specifically the tetradeuterio analog of a metabolite of almotriptan. It contains four deuterium atoms at specific positions on the ethanamine side chain, making it useful as an internal standard in analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1346604-75-8
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride)
Deuterated research compound
2-Amino Nevirapine-d3
isotope-labeled research compound
Trans-Abacavir-d4 Hydrochloride
deuterated research standard
(R)-1-Aminoindane-d3 Hydrochloride
deuterated pharmaceutical research standard
Didesmethyl almotriptan hemifumarate
analytical impurity reference standard
Almotriptan-d6 Hydrochloride
deuterated research reference standard
3-[2-(Dimethylamino)ethyl]-5-[(1-pyrrolidinylsulfonyl)methyl]-1H-indole-1-methanol
Pharmaceutical intermediate for almotriptan impurities
2-Hydroxyalmotriptan
impurity of almotriptan synthesis
1,1,2,2-tetradeuterio-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine
XLDLLAFWGVDYHM-NZLXMSDQSA-N
[2H]C([2H])(C1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)C([2H])([2H])N