Tolcapone is a pharmaceutical compound used as a selective and reversible inhibitor of catechol-O-methyltransferase (COMT). It is primarily employed in research and manufacturing related to Parkinson's disease, though its use is limited due to significant liver toxicity concerns.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 134308-13-7
(3,4-dihydroxy-5-nitrophenyl)-(4-methylphenyl)methanone
MIQPIUSUKVNLNT-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)O)O)[N+](=O)[O-]