L-Alanine tert-butyl ester hydrochloride is a protected form of the amino acid L-alanine, where the carboxyl group is masked as a tert-butyl ester and the amino group is present as the hydrochloride salt. It is primarily used as a building block in peptide synthesis and as a research reagent for studying amino acid chemistry and protein modifications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13404-22-3
Tert-Butyl-d9-amine Hydrochloride
deuterated amine research compound
Sodium 2-glycerophosphate pentahydrate
certified reference standard
(4-propylphenyl)boronic Acid
Boronic acid reagent for organic synthesis
1-Amino-11-azido-3,6,9-trioxaundecane
PEG linker for bioconjugation
D-Alanine tert-butyl ester hydrochloride
research compound
tert-butyl (2S)-2-aminopropanoate;hydrochloride
WIQIWPPQGWGVHD-JEDNCBNOSA-N
C[C@@H](C(=O)OC(C)(C)C)N.Cl