Trityllosartan is a chemical compound used as a pharmaceutical intermediate, specifically in the synthesis of the antihypertensive drug losartan. Its structure features a tetrazole ring with a trityl protecting group, which is characteristic of intermediates used in sartan-class drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 133909-99-6
(2-BUTYL-4-CHLORO-1-((2'-(1-TRITYL-1H-TETRAAZOL-5-YL)(1,1'-BIPHENYL)-4-YL)METHYL)-1H-IMIDAZOL-5-YL)METHANOL
pharmaceutical impurity standard
Alogliptin Impurity 70
pharmaceutical intermediate for alogliptin
8-Hydroxyquinoline sulfate
chelating agent for metal ions
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
4-CHLOROBENZOPHENONE
pharmaceutical intermediate
N-Trityl Olmesartan Ethyl Ester
pharmaceutical intermediate
[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol
QQPGGBNMTNDKEY-UHFFFAOYSA-N
CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN(N=N4)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)CO)Cl