Fmoc-Glu(OAll)-OH is a research compound used in peptide synthesis, featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and an allyl ester side-chain protection. It is employed as a building block for the stepwise assembly of peptides, particularly where orthogonal deprotection strategies are required.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 133464-46-7
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
Fmoc-L-aspartic acid
research compound for peptide synthesis
Fmoc-Gln(Trt)-Thr(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
Fmoc-Gln(Trt)-Ser(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
(1,10-Phenanthroline)(trifluoromethyl)(triphenylphosphine)copper(I)
copper catalyst for cross-coupling reactions
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid
LRBARFFNYOKIAX-FQEVSTJZSA-N
C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13