Dimethyl 5-nitroisophthalate is a research compound with a nitro-substituted aromatic core and two ester groups. It is primarily used as a reagent in chemical synthesis and laboratory research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13290-96-5
Methyl 3,5-dinitrobenzoate
research compound
5-Nitroisophthalic acid monomethyl ester
research intermediate for organic synthesis
Magnesium, bromo(1-methylethenyl)-
Grignard reagent for organic synthesis
Trichloroethylene-d
deuterated chemical research standard
Borane dimethyl sulfide
Complexed borane reagent for hydroboration and reductions
2-Methyl-3-isothiazolone-d3 Hydrochloride
deuterated research standard
dimethyl 5-nitrobenzene-1,3-dicarboxylate
GGTSJKFPGKFLCZ-UHFFFAOYSA-N
COC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OC