1-(2-Bromoethoxy)-4-nitrobenzene is a chemical compound used as a pharmaceutical intermediate. Its structure features a nitro-substituted aromatic ring linked to a bromoethoxy group, contributing to its utility in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13288-06-7
N-epsilon-t-Butyloxycarbonyl-L-lysine t-butyl ester hydrochloride
Pharmaceutical intermediate
(S)-1-Boc-3-methanesulfonyloxy-pyrrolidine
Pharmaceutical intermediate for pyrrolidine derivatives
(R)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
(S)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
1-(2-bromoethoxy)-4-nitrobenzene
YQWCBDNNEZHPMA-UHFFFAOYSA-N
C1=CC(=CC=C1[N+](=O)[O-])OCCBr