2,6-Dichloropurine riboside is a purine nucleoside analog consisting of a ribose sugar moiety and a 2,6-dichloropurine base. It serves as a key building block in the synthesis of various nucleoside analogue pharmaceuticals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13276-52-3
2-Chloroadenosine
adenosine receptor agonist
2-Amino-6-chloropurine riboside
pharmaceutical intermediate for nucleotide synthesis
2-Chloro-9-pentofuranosyl-9H-purin-6-amine--water (1/1)
Nucleoside analog research reagent
Ethyl (4-(3-oxomorpholino)phenyl)carbamate
pharmaceutical intermediate
2-((3-Chlorophenyl)amino)benzoic acid
pharmaceutical intermediate
4-Chloro-2,5-difluorobenzoic acid
Pharmaceutical intermediate
2-Chloro-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
pharmaceutical intermediate
(2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
HJXWZGVMHDPCRS-UUOKFMHZSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2Cl)Cl