2-Bromo-3-fluorobenzoic acid is a halogenated benzoic acid derivative used primarily as a research compound. It features both bromine and fluorine substituents on the aromatic ring, contributing to its utility in synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 132715-69-6
Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate
Research reagent for organic synthesis
2-(2-Bromophenyl)-1H-benzimidazole
research compound for crystallography studies
1,4-Bis(2-methylstyryl)benzene
Scintillation research reagent
2,2'-Bithiophene-5-boronic acid
research compound
2-bromo-3-fluorobenzoic acid
KQRCBMPPEPNNDS-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)Br)C(=O)O