4-Methylbenzoic acid anhydride is a chemical compound consisting of two 4-methylbenzoyl groups linked by an oxygen atom. It is primarily used as a research reagent in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13222-85-0
Cis-[2-(4-tert-Butyloxycarbonylamino)cyclohexyloxy]tetrahydro-2H-pyran-d5
research compound
Trans-[2-(4-tert-Butyloxycarbonylamino)cyclohexyloxy]tetrahydro-2H-pyran-d5
deuterated research compound
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-[(triphenylmethyl)carbamoyl]butanoic acid
Fmoc-protected amino acid derivative
Neohesperidin
research compound
Bis(4-chlorobenzoic) anhydride
Chemical intermediate for organic synthesis
Acetylsalicylic anhydride
impurity in aspirin
4-Amino-5-(ethylsulphonyl)-o-anisic acid, anhydride with ethyl hydrogen carbonate
impurity reference standard for amisulpride
(4-methylbenzoyl) 4-methylbenzoate
BJMLLSSSTGHJJE-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)C