tert-Butyl L-valinate is the tert-butyl ester of the amino acid L-valine. It is commonly used as a research compound in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13211-31-9
4,4'-Bipyridyl-d8
deuterated analytical reference standard
4-Methoxyhippuric acid
biochemical research reagent
Dotap chloride
cationic lipid transfection reagent
5-Cyano-2-methylindole-3-acetic acid
indole derivative research compound
H-D-Val-OtBu hydrochloride
Pharmaceutical intermediate for peptide synthesis
tert-butyl (2S)-2-amino-3-methylbutanoate
RJBVJBGFJIHJSZ-ZETCQYMHSA-N
CC(C)[C@@H](C(=O)OC(C)(C)C)N