2-(Trifluoromethyl)pyridine-3-carboxylic acid is a chemical compound featuring a pyridine ring substituted with a trifluoromethyl group and a carboxylic acid group. It is used as a research reagent in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 131747-43-8
(2-(trifluoromethyl)pyridin-3-yl)methanol
research compound
(1S)-1-(2-chlorophenyl)ethan-1-ol
research compound
3-Fluoro-5-hydrazinylpyridine
Research compound
4-Iodo-2-methylaniline
Research compound for crystallography
2-(trifluoromethyl)pyridine-3-carboxylic acid
BFROETNLEIAWNO-UHFFFAOYSA-N
C1=CC(=C(N=C1)C(F)(F)F)C(=O)O