This compound is a synthetic research peptide composed of eleven amino acid residues. Due to its large size, high flexibility, and multiple undefined stereocenters, it is primarily used as a research compound for laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 131602-53-4
2,4-dichloro-6-methylpyrimidin-5-amine
research compound
(trimethylsilyl)methylmagnesium chloride
Grignard reagent for organic synthesis
Z-Gly-Gly-Phe-OH
research compound
2-(trifluoromethyl)pyridine-4-carboxylic acid
research compound
2-[[2-[[2-[[2-[[2-[2-[[2-[[6-amino-2-[[4-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetyl]amino]propanoylamino]-3-methylpentanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid
WIHBNMPFWRHGDF-UHFFFAOYSA-N
CCC(C)C(C(=O)NC(C(C)CC)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)O)NC(=O)C(C)NC(=O)CNC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)CN