tert-Butoxycarbonyl-L-leucine (Boc-Leu-OH) is a derivative of the amino acid L-leucine, where the amino group is protected by a tert-butoxycarbonyl (Boc) group. It is widely used as a building block in solid-phase peptide synthesis, enabling the sequential assembly of peptides while preventing unwanted side reactions at the amine site.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13139-15-6
Tert-butyl (S)-(1-cyclopropyl-2-hydroxyethyl)carbamate
Peptide synthesis intermediate
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioic acid
Peptide synthesis intermediate
L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[imino[[(4-methylphenyl)sulfonyl]amino]methyl]-
Peptide synthesis intermediate
Fmoc-His-Aib-OH
Peptide synthesis intermediate
N-(tert-Butoxycarbonyl)-L-isoleucine
peptide synthesis intermediate
بيروكسيد الزنك
topical antiseptic and astringent
(3R,4R)-1-Boc-4-fluoro-3-piperidinol
pharmaceutical intermediate
3,5-TIPS-N-PAc-Guanosine
Nucleoside protecting group intermediate
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
MDXGYYOJGPFFJL-QMMMGPOBSA-N
CC(C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C