N-(2-Pyridyl)oxamic acid is a research compound featuring a carboxylic acid and an amide group attached to a pyridine ring. It is primarily used as a laboratory reagent for chemical synthesis and investigative studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13120-39-3
Rhodium(2+) (2S)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoate--ethyl acetate (2/4/1)
research compound for catalysis
Benzene-d, 4-bromo-
deuterated research compound
1-Chloro-4-deuteriobenzene
Deuterated research reference compound
Azido-PEG2-NHS ester
PEGylation reagent for bioconjugation
2-oxo-2-(pyridin-2-ylamino)acetic acid
RQLBRIIHVJSCTG-UHFFFAOYSA-N
C1=CC=NC(=C1)NC(=O)C(=O)O