5-Acetylsalicylic acid is a chemical compound that serves as a pharmaceutical intermediate, specifically used in the production of acetylsalicylic acid (aspirin) and as a reference impurity standard for quality control in pharmaceutical manufacturing. It is a derivative of salicylic acid, a naturally occurring plant hormone originally derived from willow bark.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13110-96-8
4-Hydroxyisophthalic acid
chemical intermediate for synthesis
(2-Aminothiazol-5-yl)methanol
Pharmaceutical intermediate
8-BROMO-5,6-DIFLUORO-2-METHYLQUINOLINE
pharmaceutical intermediate
Tert-butyl 4-(chloromethyl)-4-(hydroxymethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for piperidine derivatives
TERT-BUTYL 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NAPHTHALEN-2-YLCARBAMATE
Pharmaceutical intermediate for API synthesis
5-acetyl-2-hydroxybenzoic acid
NZRDKNBIPVLNHA-UHFFFAOYSA-N
CC(=O)C1=CC(=C(C=C1)O)C(=O)O