This compound is the benzyl ester derivative of L-glutamic acid. It is primarily used as an intermediate in peptide synthesis, particularly in the construction of glutamate-containing peptides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13030-09-6
Fmoc-3-Ala(2-thienyl)-OH
Peptide synthesis building block
4-(Boc-amino)cyclohexanecarboxylic Acid
pharmaceutical intermediate
1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone
Pharmaceutical intermediate
(1R,2S)-2-Fluorocyclopropane-1-carboxylic acid
pharmaceutical intermediate
(4S)-4-amino-5-oxo-5-phenylmethoxypentanoic acid
HFZKKJHBHCZXTQ-JTQLQIEISA-N
C1=CC=C(C=C1)COC(=O)[C@H](CCC(=O)O)N