This compound is a chemical compound used primarily as an intermediate in the synthesis of dyes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 130-23-4
Benzonitrile, 2-[2-[4-[2-(4-cyanophenyl)ethenyl]phenyl]ethenyl]-
Fluorescent brightener
4,4'-(1,4-Phenylenedi-2,1-ethenediyl)bis[benzonitrile]
fluorescent brightener
Cobalt(II) oxide
Ceramics pigment and enamel colorant
Chromium(III) oxide
Pigment for paints and polymers
4-amino-5-hydroxynaphthalene-1,7-disulfonic acid
ZUQOBHTUMCEQBG-UHFFFAOYSA-N
C1=CC(=C2C=C(C=C(C2=C1N)O)S(=O)(=O)O)S(=O)(=O)O