This compound is a chiral piperazine derivative with a tert-butyl ester protecting group. It is primarily used as a building block in the synthesis of more complex molecules for pharmaceutical research and development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 129779-30-2
Ethyl Piperazine-2-carboxylate Dihydrochloride
Pharmaceutical intermediate
1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-methyl 1,2-piperazinedicarboxylate
pharmaceutical intermediate for synthesis
(1r,2s,3s,4r,5s)-1-(acetoxymethyl)-5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate
pharmaceutical intermediate
tert-butyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate
NUZXPHIQZUYMOR-DTORHVGOSA-N
C[C@@H]1CN(C[C@@H](N1)C)C(=O)OC(C)(C)C