It is characterized by a pyridine ring containing an aldehyde group and a trifluoromethyl substituent, with a molecular weight of 191. 02, LogP of 1.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1289147-09-6
4-fluoro-2-methylamino-benzoic Acid
research compound
Tert-butyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate
research compound
Rac-tert-butyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate
research compound
3,4-dihydro-5-(4-(1-piperidinyl)butoxy)-1(2H)-isoquinolinone
PARP inhibitor research compound
6-oxo-5-(trifluoromethyl)-1H-pyridine-3-carbaldehyde
KZQWRFDJRGQACX-UHFFFAOYSA-N
C1=C(C(=O)NC=C1C=O)C(F)(F)F
—