2-Nitrofluorene-d9 is a deuterated research standard, specifically a nonadeuterio-labeled derivative of 7-nitrofluorene. Its primary significance lies in its use as an isotopically labeled reference compound for analytical and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 128008-87-7
2-Bromonicotinaldehyde
research compound
4-Bromo-2-fluoropyridine
research reagent
3-(Dimethylamino)propyl chloride hydrochloride
research intermediate for organic synthesis
2'-OMe PAC Abeta-cyanoethyl phosphoramidite
Oligonucleotide synthesis phosphoramidite building block
1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene
XFOHWECQTFIEIX-MFNUZUOVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H]