This compound is a deuterated derivative of 3,4-dichlorobiphenyl, a polychlorinated biphenyl (PCB) analog. It is primarily used as an analytical reference standard in research, particularly for mass spectrometry and internal standard applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1276197-19-3
Hydroxy Atrazine-d5
deuterated analytical reference standard
3,5-Dichlorobiphenyl-2',3',4',5',6'-d5
deuterated reference standard
(Rac)-Atropine-d3
deuterated analytical reference standard
2-Chloroaniline-d6
deuterated research standard
1,2,3,4,5-pentadeuterio-6-(3,4-dichlorophenyl)benzene
ZGHQUYZPMWMLBM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC(=C(C=C2)Cl)Cl)[2H])[2H]