This compound is a pharmaceutical intermediate used in laboratory-scale synthesis. It features an amide functional group and aromatic rings, contributing to its chemical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 127033-74-3
1-Methyl-1H-pyrazol-4-ylamine hydrochloride
Pharmaceutical intermediate
N-Demethyl-N-formyl Clarithromycin
Clarithromycin impurity
Clarithromycin Impurity L
macrolide antibiotic impurity reference standard
(3R)-piperidin-3-amine
Pharmaceutical intermediate for API synthesis
Tranilast
antiallergic active pharmaceutical ingredient
(E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide
GVTLFGJNTIRUEG-ZHACJKMWSA-N
COC1=CC=CC(=C1)NC(=O)/C=C/C2=CC=CC=C2