4-Bromo-3-nitropyridine hydrochloride is a chemical compound featuring a pyridine ring substituted with bromine and nitro groups, typically supplied as a hydrochloride salt. It is primarily used as a research chemical intermediate in organic synthesis and laboratory-scale reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1260816-42-9
(+)-O-DesMethyl TraMadol-D6
Deuterated analytical reference standard
Rac N,O-Didesmethyl Tramadol-d3
deuterated analytical reference standard
4-Chloro-3-iodo-2-methoxypyridine
research compound
2-(2-Amino-3-hydroxy-2-(hydroxymethyl)propoxy)-1-hydroxypropyl)phosphonic acid
Research reagent
4-bromo-3-nitropyridine;hydrochloride
OEUXXJASPJSLDW-UHFFFAOYSA-N
C1=CN=CC(=C1Br)[N+](=O)[O-].Cl