Atorvastatin Acetonide tert-Butyl Ester is a chemical compound used as an intermediate in the manufacturing of atorvastatin, a statin medication. It features a complex structure incorporating a pyrrole ring, acetonide protecting group, and tert-butyl ester moiety.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 125971-95-1
2-(2-(4-fluorophenyl)-2-oxo-1-phenylethyl)-4-methyl-3-oxo-N-phenylpentanamide
pharmaceutical intermediate
(4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate
Atorvastatin Intermediate
Di-tert-butyl (R)-4-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for synthesis
(R)-2-AMINO-4-(NAPHTHALEN-1-YL)BUTANOIC ACID
Pharmaceutical intermediate for agomelatine impurities
tert-butyl 2-[(4R,6R)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate
NPPZOMYSGNZDKY-ROJLCIKYSA-N
CC(C)C1=C(C(=C(N1CC[C@@H]2C[C@@H](OC(O2)(C)C)CC(=O)OC(C)(C)C)C3=CC=C(C=C3)F)C4=CC=CC=C4)C(=O)NC5=CC=CC=C5