This compound is a piperidine-based carboxylic acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a hydroxyl substituent. It serves as a pharmaceutical intermediate primarily utilized in the synthesis of drug candidates.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1251032-53-7
Ticagrelor metabolite M5
pharmaceutical metabolite impurity standard
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
Tert-butyl (S)-(1-(4-ethoxyphenyl)-3-hydroxypropan-2-yl)carbamate
Boc-protected amino alcohol intermediate
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
2-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-2-methylpropanoic acid
NUJXHFXAZXQBFA-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)(C(C)(C)C(=O)O)O
—