Tuberonic acid is a plant hormone and metabolite belonging to the jasmonate family, which regulates growth, photosynthesis, and reproductive development. It plays a critical role in plant defense against herbivory and responses to environmental stresses, and can also act as a volatile organic compound for inter-plant communication.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 124649-26-9
2-[(1R,2S)-2-[(Z)-5-hydroxypent-2-enyl]-3-oxocyclopentyl]acetic acid
RZGFUGXQKMEMOO-SZXTZRQCSA-N
C1CC(=O)[C@H]([C@H]1CC(=O)O)C/C=C\CCO