This compound is a pharmaceutical intermediate related to bendamustine, featuring a complex structure with multiple aromatic rings, amine groups, and halogen atoms. It is primarily used in research and manufacturing settings as a reference standard or building block for bendamustine-related compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1228551-91-4
Bendamustine
alkylating antineoplastic active pharmaceutical ingredient
Bendamustine hydrochloride
active pharmaceutical ingredient
Boc-(s)-2-amino-2-(3-bromophenyl)acetic acid
Boc-protected amino acid intermediate
Benzyl 4-(hydroxymethyl)piperidine-1-carboxylate
pharmaceutical intermediate
3-nitro-4-(oxan-4-ylmethylamino)benzenesulfonamide
Pharmaceutical intermediate
Piperazine, 1-[[2-(4-chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl]-
pharmaceutical intermediate for API synthesis
4-[5-[2-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoyloxy]ethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid
RSSXIQCZWSXHBO-UHFFFAOYSA-N
CN1C2=C(C=C(C=C2)N(CCOC(=O)CCCC3=NC4=C(N3C)C=CC(=C4)N(CCCl)CCCl)CCCl)N=C1CCCC(=O)O