Methyl 5-Bromo-2-methoxynicotinate is a chemical compound used primarily as a research reagent. It is a functionalized pyridine derivative bearing ester, ether, and halogen groups, commonly employed in laboratory-scale organic synthesis and medicinal chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 122433-41-4
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
Cyclooctene;iridium;dichloride
organoiridium catalyst precursor
(2S)-2-((2-(2-(2-(2-(2-(2-(2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethylamino)-2-oxoethoxy)acetyl)amino)-N-(4-(hydroxymethyl)phenyl)-6-(((4-methoxyphenyl)-diphenylmethyl)amino)hexanamide
PEGylated bifunctional linker reagent
(9,9-Diphenyl-9H-fluoren-4-yl)boronic acid
research compound
6-chloro-5-fluoro-1H-indole
research compound
methyl 5-bromo-2-methoxypyridine-3-carboxylate
OLQOVEOEHQDKSC-UHFFFAOYSA-N
COC1=C(C=C(C=N1)Br)C(=O)OC
—