This compound is an Fmoc-protected, alpha-methylated derivative of 2,6-difluorophenylalanine, commonly used as a building block in solid-phase peptide synthesis. Its structure incorporates a fluorenylmethoxycarbonyl (Fmoc) group for temporary amine protection, enabling the stepwise assembly of peptides containing a sterically hindered, fluorinated amino acid residue.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1223105-51-8
FMoc-alpha-Me-D-Phe(2-F)-OH
Fmoc-protected amino acid for peptide synthesis
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-fluorophenyl)-2-methylpropanoic acid
Research reagent for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid
Fmoc-protected amino acid for peptide synthesis
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
N-(9-Fluorenylmethoxycarbonyl)-D-proline
Fmoc-protected amino acid for peptide synthesis
2'-guanylic acid
ribonuclease T1 inhibitor
(4-(benzyloxy)-3,5-difluorophenyl)methanol
research compound
(2S)-3-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid
MRIVYBRWULFPFJ-VWLOTQADSA-N
C[C@](CC1=C(C=CC=C1F)F)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24