This compound is a deuterated form of 4-isopropylphenol, where all hydrogen atoms are replaced with deuterium. It is commonly used as a labeled research compound for analytical and tracing studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219805-27-2
(+/-)-Ketoprofen-d4
deuterated analytical reference standard
4-N-PENTYLPHENOL-D16
Deuterated research reference standard
2,6-Dichlorobenzoic acid-d3
deuterated research reagent
2,4,6-trimethylpyridine-d11
deuterated analytical reference standard
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene
YQUQWHNMBPIWGK-SRQDVOKDSA-N
[2H]C1=C(C(=C(C(=C1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H])O[2H])[2H]