1,3-Diethylbenzene-d14 is a fully deuterated form of 1,3-diethylbenzene, used primarily as a reference standard in analytical chemistry. Its isotopic labeling provides distinct mass spectrometric characteristics, making it valuable for quantification and calibration in gas chromatography and mass spectrometry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219803-40-3
Caproic acid-6,6,6-d3
deuterated reference standard for analytical chemistry
4-Aminopiperidine-3,3,4,5,5-d5
deuterated research compound
2,5-dichlorophenol-3,4,6-d3
deuterated research reference standard
1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one
Deuterated internal standard for analysis
Cetirizine D4
Deuterated research reference standard
1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene
AFZZYIJIWUTJFO-NFUPRKAOSA-N
[2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H]