This compound is a deuterated research standard, specifically a pentyl ester of 4-hydroxybenzoic acid where the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a labeled reference compound in analytical chemistry and mass spectrometry for quantification or tracing studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219798-66-9
N-butyl 4-hydroxybenzoate-2,3,5,6-d4
cosmetic preservative
N-propyl 4-hydroxybenzoate-2,3,5,6-d4
Preservative in cosmetics and personal care
3,4-difluorobenzoic-d3 acid
research compound
4-Methoxyphenyl-2,3,5,6-d4-acetonitrile
deuterated research compound
1,2-Phenylenediamine-d8
deuterium-labeled research compound
2,4-Difluorotoluene-3,5,6-d3
deuterium-labeled research compound
pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate
ZNSSPLQZSUWFJT-KDWZCNHSSA-N
[2H]C1=C(C(=C(C(=C1C(=O)OCCCCC)[2H])[2H])O)[2H]