3,4,5-Trifluorobenzoic acid is a fluorinated benzoic acid derivative used as a probe in structural chemistry studies, particularly in examining crystal packing and hydrogen-bonding patterns of benzoic acids. It is a polar aromatic compound with a carboxylic acid group and three fluorine substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 121602-93-5
3,4,5-trifluorobenzoic acid
VJMYKESYFHYUEQ-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)F)F)C(=O)O