DPPF (1,1'-bis(diphenylphosphino)ferrocene) is a research reagent primarily used as an ionophore in chemical sensing applications. Its structure features a ferrocene backbone with two diphenylphosphino groups, enabling selective ion binding and detection.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 12150-46-8
(1,1'-Bis(diphenylphosphino)ferrocene)dichloropalladium
palladium catalyst for cross-coupling reactions
[1,1'-Bis(diphenylphosphino)ferrocene]palladium(II) chloride dichloromethane complex
Cross-coupling catalyst in organic synthesis
(r)-4-(trimethylsilyl)-3-butyn-2-ol
research chemical
Midazolam 2,5-Dioxide-d6
deuterated analytical reference standard
N-Acetyl Sulfamethoxazole-d4 (major)
Research compound for metabolite analysis
Zolpidem-d6 6-Carboxylic Acid Methyl Ester
research compound
bis(cyclopenta-1,4-dien-1-yl(diphenyl)phosphane);iron(2+)
KZPYGQFFRCFCPP-UHFFFAOYSA-N
[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Fe+2]