Methyl N-benzyloxycarbonylglycinate is a protected amino acid intermediate commonly used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino function and a methyl ester on the carboxyl group, making it a versatile building block for pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1212-53-9
Ethyl N-benzyloxycarbonyl-2-glycinate
research compound for peptide synthesis
N-Benzyloxycarbonylglycine
Protecting group reagent for peptide synthesis
(2S,4R)-1-tert-Butyl 2-methyl 4-((tert-butyldimethylsilyl)oxy)pyrrolidine-1,2-dicarboxylate
protected amino acid intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-3-(2-methylpyridin-4-yl)propanoic acid
protected amino acid intermediate
(R)-1-(3-CHLOROPHENYL)-2-METHYLPROPAN-1-AMINE
Pharmaceutical intermediate
1-Ethoxy-2,3-Difluorobenzene
Pharmaceutical intermediate
methyl 2-(phenylmethoxycarbonylamino)acetate
DZYBBBYFLOPVOL-UHFFFAOYSA-N
COC(=O)CNC(=O)OCC1=CC=CC=C1