This compound is a chemical compound used primarily as a research reagent. Its structure features a benzodioxole ring with two fluorine atoms, an aromatic ring, and hydroxyl and ether functional groups, giving it moderate polarity and low molecular weight.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1211539-82-0
Diacetic Aceclofenac
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
Epicatechin gallate
polyphenol with enzyme inhibition activity
2,2-difluoro-1,3-benzodioxol-5-ol
GEHVTOIGEVNIEQ-UHFFFAOYSA-N
C1=CC2=C(C=C1O)OC(O2)(F)F