6-Bromo-5-(trifluoromethyl)pyridin-3-ol is a research compound featuring a pyridine ring with bromine and trifluoromethyl substituents. Its structure includes an aromatic heterocycle and halogen groups, making it of interest for synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1211539-16-0
5-Hydroxy-3-(trifluoromethyl)picolinic acid
research chemical intermediate
5-bromo-3-(trifluoromethyl)pyridine-2-carboxylic acid
research compound
Methyl 5-hydroxy-3-(trifluoromethyl)picolinate
research compound
3-BROMO-2-CHLORO-5-IODOPYRIDINE
Research reagent for organic synthesis
6-bromo-5-(trifluoromethyl)pyridin-3-ol
GEODJYNOFUSNSI-UHFFFAOYSA-N
C1=C(C=NC(=C1C(F)(F)F)Br)O
—