3-(Benzoylmethylamino)-2-fluorobenzoic acid is a chemical compound with the molecular formula C15H12FNO3. It is a structural analog featuring a benzoylmethylamino group at the 3-position and a fluorine atom at the 2-position on a benzoic acid core.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1207726-86-0
2-fluoro-3-(phenacylamino)benzoic acid
YQIHNEWWIFUYJX-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)CNC2=CC=CC(=C2F)C(=O)O
—