Tert-butyl 4-iodobenzoate is an organic compound featuring an aromatic ring substituted with an iodine atom and a tert-butyl ester group. It is primarily used as a research chemical intermediate in laboratory synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 120363-13-5
3-[(4-Chlorophenyl)methoxy]-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide
Research compound
2,7-Diazaspiro[4.4]nonan-1-one hydrochloride
research compound
1,7-diazaspiro[4.4]nonan-6-one hydrochloride
research compound
20-Hydroxy-3,6,9,12,15,18-hexaoxaicosanoic acid
PEG-based research compound for bioconjugation
tert-butyl 4-iodobenzoate
QHHNHUWOOFETNQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=C(C=C1)I