Cinnarizine EP Impurity D is a chemical compound identified as an impurity reference standard for cinnarizine. It is characterized by a piperazine core with benzhydryl and diphenylhexadienyl substituents, making it a non-polar, aromatic, and ring-containing compound.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1199751-98-8
1-benzhydryl-4-[(1E,5E)-1,6-diphenylhexa-1,5-dien-3-yl]piperazine
FFKBIJDNNHKVGD-KNWAISMVSA-N
C1CN(CCN1C(C/C=C/C2=CC=CC=C2)/C=C/C3=CC=CC=C3)C(C4=CC=CC=C4)C5=CC=CC=C5