This compound is the dihydrochloride salt of (3S)-1-azabicyclo[2. 2.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 119904-90-4
(S)-quinuclidin-3-amine
pharmaceutical intermediate
Z944
T-type calcium channel blocker
Ertapenem N-Carbonyl Dimer Impurity
Pharmaceutical impurity reference standard
بنزوات البنزيل
scabicide and insect repellent
(R)-lipoate
nutritional supplement active ingredient
(R)-(+)-3-Aminoquinuclidine dihydrochloride
Pharmaceutical intermediate
3-QUINUCLIDINOL
precursor in pharmaceutical synthesis
(R)-(-)-3-Quinuclidinol
pharmaceutical intermediate
(3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride
STZHBULOYDCZET-XCUBXKJBSA-N
C1CN2CCC1[C@@H](C2)N.Cl.Cl