1,2,4,5-Tetrachlorobenzene-d2 is a deuterated research standard used primarily in analytical and structural chemistry. Its isotopic labeling makes it valuable as an internal standard in mass spectrometry and nuclear magnetic resonance studies, particularly for investigating chlorinated aromatic compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1198-57-8
1,3,5-Trichlorobenzene-d3
Deuterated analytical reference standard
4-Phenyl-2-pyrrolidinone
Research compound for organic synthesis
2-Amino-1-(3-chlorophenyl)propan-1-one
research compound
Ethyl all cis-7,10,13,16,19-Docosapentaenoate
research compound
1,2,4,5-tetrachloro-3,6-dideuteriobenzene
JHBKHLUZVFWLAG-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1Cl)Cl)[2H])Cl)Cl