4-Methyl-3-nitroaniline is an organic compound used primarily as a dye intermediate. Its structure features an aromatic ring substituted with an amino group, a nitro group, and a methyl group, contributing to its use in the synthesis of various dyes and pigments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 119-32-4
4-Hydroxy-7-(phenylamino)naphthalene-2-sulfonic acid
dye intermediate for azo dyes
5-Amino-2-[(4-aminophenyl)amino]benzenesulfonic acid
dye intermediate
4-Nitro-4'-aminostilbene-2,2'-disulfonic acid
stilbene dye intermediate
5-amino-2-[(E)-2-[4-(3-methyl-5-oxo-4H-pyrazol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid
dye intermediate
4-methyl-3-nitroaniline
GDIIPKWHAQGCJF-UHFFFAOYSA-N
CC1=C(C=C(C=C1)N)[N+](=O)[O-]