Pteroic acid is a chemical compound that serves as a direct precursor in the biosynthesis of folic acid. It consists of a pterin ring system linked to a 4-aminobenzoic acid moiety, containing both aromatic and heterocyclic structures with carboxylic acid and amine functional groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 119-24-4
L-Homocitrulline
research compound
N-Acetylcysteamine
research reagent
[(2R)-pyrrolidin-2-yl]methanamine dihydrochloride
research compound
Methyl 6-chloro-2-oxo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
research compound
Folic acid
Vitamin nutritional factor
Folic acid dihydrate
active pharmaceutical ingredient
N-Nitrosofolic acid
nitrosamine impurity standard for folic acid
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoic acid
JOAQINSXLLMRCV-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N