1,4-This compound is a chemical compound used as a pharmaceutical intermediate. It contains ester functional groups and is employed in the synthesis of other compounds for research and manufacturing purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1187-74-2
Tert-butyl N-[5-(trifluoromethyl)pyridin-3-yl]carbamate
pharmaceutical intermediate
Methyl (2S)-2-oxiranecarboxylate
chiral building block for synthesis
(S)-(+)-Glycidyl-4-nitrobenzoate
Chiral building block for synthesis
1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-5-ol
Benzoxaborole pharmaceutical intermediate
diethyl 2-(2-oxopropyl)butanedioate
AAPVOVKOHNCXJA-UHFFFAOYSA-N
CCOC(=O)CC(CC(=O)C)C(=O)OCC