Acetic acid-d4 is a deuterated form of acetic acid where all hydrogen atoms are replaced by deuterium. It is primarily used as a solvent in nuclear magnetic resonance (NMR) spectroscopy due to its minimal interference with proton NMR signals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1186-52-3
Methanol-d
NMR solvent
(2H6)Ethanol
NMR solvent
Methylene chloride-D2
NMR solvent
Octadeuterotetrahydrofuran
NMR solvent
N-(5-((4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamoyl)-2-methylphenyl)-5-(thiophen-2-yl)pyridine-3-carboxamide (6)
research compound
2-(4-bromophenyl)-5-phenylthiophene
Research reagent for organic synthesis
Butyl (S)-oxirane-2-carboxylate
research compound
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
deuterio 2,2,2-trideuterioacetate
QTBSBXVTEAMEQO-GUEYOVJQSA-N
[2H]C([2H])([2H])C(=O)O[2H]