2-Bromo-5-picoline-d3 is a deuterated research compound where the methyl group is labeled with three deuterium atoms. It is primarily used in analytical and synthetic chemistry as a stable isotope-labeled building block.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1185306-03-9
3-Bromotoluene-d7
deuterated research compound
5-Acetylpyrazine-2-carboxylic acid
Chemical research intermediate
Vitamin D3-d6
Isotope-labeled reference standard
N-benzyl-3,6-dibromocarbazole
Research reagent for crystallography and synthesis
2-Bromo-5-methylpyridine
chemical research intermediate
2-bromo-5-(trideuteriomethyl)pyridine
YWNJQQNBJQUKME-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CN=C(C=C1)Br