Hexaphenoxycyclotriphosphazene is an industrial chemical used primarily as a flame retardant additive. It is incorporated into materials such as plastics, textiles, and surface coatings to inhibit or slow the spread of fire through various physical and chemical mechanisms.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1184-10-7
Melamine pyrophosphate
Flame retardant additive
1,2,5,6-Tetrabromocyclooctane
Flame retardant additive
Melamine phosphate
Flame retardant additive
Tris(2,3-dibromopropyl) isocyanurate
Flame retardant additive
Pivalic acid, sodium salt
chemical intermediate for organic synthesis
Methyltrimethoxysilane
Coupling agent and cross-linker
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate
catalyst reagent for chemical synthesis
Tetraethylurea
Industrial chemical intermediate
2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene
RNFJDJUURJAICM-UHFFFAOYSA-N
C1=CC=C(C=C1)OP2(=NP(=NP(=N2)(OC3=CC=CC=C3)OC4=CC=CC=C4)(OC5=CC=CC=C5)OC6=CC=CC=C6)OC7=CC=CC=C7