This compound is a polychlorinated nitroaniline derivative used as an intermediate in pharmaceutical manufacturing. It features an aromatic ether structure with multiple halogen substituents and an amine group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 118353-04-1
RU Phosphoramidite
RNA oligonucleotide synthesis building block
(R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate
Pharmaceutical intermediate for API synthesis
4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid
pharmaceutical intermediate
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid
protected amino acid for peptide synthesis
4-chloro-5-(2,3-dichlorophenoxy)-2-nitroaniline
WZFITXMPNXRORE-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C(=C2)N)[N+](=O)[O-])Cl